Difference between revisions of "Tiso gene 7349"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Tiso_gene_7349 == * right end position: ** 10042 * transcription direction: ** NEGATIVE * left end position: ** 5146 * centisome position: ** 45.6367...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
+
== Gene Tiso_gene_7349 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 10042
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** dihomo γ-linolenoyl-CoA
+
** 5146
−
* molecular weight:
+
* centisome position:
−
** 1051.975    
+
** 45.63675    
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z)-icosatrienoyl-CoA
 
−
** (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
 
−
** (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13435]]
+
* Reaction: [[GDPPYPHOSKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[GTPPYPHOSKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PPGPPMET-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10042}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581179 71581179]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=5146}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264]
+
{{#set: centisome position=45.63675   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=GDPPYPHOSKIN-RXN|GTPPYPHOSKIN-RXN}}
−
{{#set: inchi key=InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J}}
+
{{#set: pathway associated=PPGPPMET-PWY}}
−
{{#set: common name=dihomo γ-linolenoyl-CoA}}
+
−
{{#set: molecular weight=1051.975   }}
+
−
{{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}}
+
−
{{#set: consumed by=RXN-13435}}
+

Latest revision as of 21:21, 21 March 2018

Gene Tiso_gene_7349

  • right end position:
    • 10042
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 5146
  • centisome position:
    • 45.63675
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7349&oldid=48094"