Difference between revisions of "DAMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(4'-meth...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * common...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** dAMP |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 329.208 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxyadenosine 5'-phosphate |
+ | ** deoxyadenosine-phosphate | ||
+ | ** 2'-deoxyadenosine 5''-monophosphate | ||
+ | ** 2'-dAMP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DEOXYADENYLATE-KINASE-RXN]] |
+ | * [[ATDAM]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14195]] | ||
+ | * [[DAD2PT]] | ||
+ | * [[RXN-14215]] | ||
+ | * [[RXN0-384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DAMPH]] |
== External links == | == External links == | ||
+ | * CAS : 653-63-4 | ||
+ | * BIGG : damp | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22848660 22848660] |
− | {{#set: smiles= | + | * HMDB : HMDB00905 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00360 C00360] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.18735032.html 18735032] |
− | {{#set: consumed by= | + | * CHEBI: |
− | {{#set: reversible reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58245 58245] |
+ | * METABOLIGHTS : MTBLC58245 | ||
+ | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O}} | ||
+ | {{#set: common name=dAMP}} | ||
+ | {{#set: inchi key=InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L}} | ||
+ | {{#set: molecular weight=329.208 }} | ||
+ | {{#set: common name=2'-deoxyadenosine 5'-phosphate|deoxyadenosine-phosphate|2'-deoxyadenosine 5''-monophosphate|2'-dAMP}} | ||
+ | {{#set: consumed by=DEOXYADENYLATE-KINASE-RXN|ATDAM}} | ||
+ | {{#set: produced by=RXN-14195|DAD2PT|RXN-14215|RXN0-384}} | ||
+ | {{#set: reversible reaction associated=DAMPH}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite DAMP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O
- common name:
- dAMP
- inchi key:
- InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L
- molecular weight:
- 329.208
- Synonym(s):
- 2'-deoxyadenosine 5'-phosphate
- deoxyadenosine-phosphate
- 2'-deoxyadenosine 5-monophosphate
- 2'-dAMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 653-63-4
- BIGG : damp
- PUBCHEM:
- HMDB : HMDB00905
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58245
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.