Difference between revisions of "TransportSeed CA+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * inchi key: ** InChIKey=HMFHBZSHGG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CA+2 TransportSeed_CA+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CA+2 TransportSeed_CA+2] ==
* smiles:
+
* direction:
** C(O)C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
+
* common name:
+
** α-L-arabinofuranose
+
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** α-L-arabinose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[3.2.1.55-RXN]]
+
** 1.0 [[CA+2]][e] '''=>''' 1.0 [[CA+2]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 Ca2+[e] '''=>''' 1.0 Ca2+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03142
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: in pathway=}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935]
+
{{#set: reconstruction category=manual}}
* CHEMSPIDER:
+
{{#set: reconstruction source=manual-import_from_medium}}
** [http://www.chemspider.com/Chemical-Structure.393416.html 393416]
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772]
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}}
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}}
+
{{#set: common name=α-L-arabinofuranose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=α-L-arabinose}}
+
{{#set: produced by=3.2.1.55-RXN}}
+

Latest revision as of 20:21, 21 March 2018

Reaction TransportSeed_CA+2

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Ca2+[e] => 1.0 Ca2+[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links