Difference between revisions of "CPD-15834"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6376 == * left end position: ** 2643 * transcription direction: ** POSITIVE * right end position: ** 7383 * centisome position: ** 21.55791...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C |
| − | * | + | * common name: |
| − | ** | + | ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 410.639 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14917]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035] | ||
| + | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}} | ||
| + | {{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}} | ||
| + | {{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}} | ||
| + | {{#set: molecular weight=410.639 }} | ||
| + | {{#set: produced by=RXN-14917}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-15834
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
- common name:
- 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
- inchi key:
- InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
- molecular weight:
- 410.639
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
