Difference between revisions of "CPD-15834"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15561 RXN-15561] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15561 RXN-15561] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.2.27 EC-2.3.2.27]
+
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
 +
* inchi key:
 +
** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
 +
* molecular weight:
 +
** 410.639   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Protein-L-lysine]][c] '''+''' 1 [[S-ubiquitinyl-UCP-E2-L-cysteine]][c] '''=>''' 1 [[Ubiquitin-carrier-protein-E2-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c]
+
* [[RXN-14917]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [protein]-L-lysine[c] '''+''' 1 an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''=>''' 1 an [E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.2.27}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738]
−
{{#set: in pathway=PWY-7511}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035]
 +
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}}
 +
{{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
 +
{{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}}
 +
{{#set: molecular weight=410.639    }}
 +
{{#set: produced by=RXN-14917}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-15834

  • smiles:
    • CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
  • common name:
    • 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
  • inchi key:
    • InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
  • molecular weight:
    • 410.639
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15834&oldid=48102"