Difference between revisions of "RXN-13431"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13431 RXN-13431] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13431 RXN-13431] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 21 [[PROTON]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 13 [[NADPH]][c] '''+''' 9 [[MALONYL-COA]][c] '''=>''' 1 [[5Z8Z11Z14Z17Z-EICOSAPENTAENOATE]][c] '''+''' 8 [[WATER]][c] '''+''' 9 [[CARBON-DIOXIDE]][c] '''+''' 10 [[CO-A]][c] '''+''' 13 [[NADP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 21 H+[c] '''+''' 1 acetyl-CoA[c] '''+''' 13 NADPH[c] '''+''' 9 malonyl-CoA[c] '''=>''' 1 icosapentaenoate[c] '''+''' 8 H2O[c] '''+''' 9 CO2[c] '''+''' 10 coenzyme A[c] '''+''' 13 NADP+[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | == Pathways == |
| + | * [[PWY-7050]], icosapentaenoate biosynthesis IV (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7050 PWY-7050] | ||
| + | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.1}} | |
| − | + | {{#set: in pathway=PWY-7050}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction comment=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:21, 21 March 2018
Contents
Reaction RXN-13431
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 21 PROTON[c] + 1 ACETYL-COA[c] + 13 NADPH[c] + 9 MALONYL-COA[c] => 1 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE[c] + 8 WATER[c] + 9 CARBON-DIOXIDE[c] + 10 CO-A[c] + 13 NADP[c]
- With common name(s):
- 21 H+[c] + 1 acetyl-CoA[c] + 13 NADPH[c] + 9 malonyl-CoA[c] => 1 icosapentaenoate[c] + 8 H2O[c] + 9 CO2[c] + 10 coenzyme A[c] + 13 NADP+[c]
Genes associated with this reaction
Pathways
- PWY-7050, icosapentaenoate biosynthesis IV (bacteria): PWY-7050
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
