Difference between revisions of "3-Ketopimeloyl-ACP-methyl-esters"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] == * common name: ** a 3-oxo...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] ==
−
* smiles:
+
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 3-monophosphate
+
** a 3-oxo-pimeloyl-[acp] methyl ester
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-L-myo-inositol-1-p
+
** a 3-ketopimelyl-[acp] methyl ester
−
** L-myo-inositol 1-phosphate
+
** a 3-ketopimeloyl-[acyl-carrier protein] methyl ester
−
** inositol 1-phosphate
+
** a 3-oxo-pimelyl-[acp] methyl ester
−
** myo-inositol 1-phosphate
+
** a 3-ketopimeloyl-[acp] methyl ester
−
** 1D-myo-inositol 3-phosphate
+
−
** Ins(3)P1
+
−
** D-myo-inositol (3)-monophosphate
+
−
** myo-inositol 1-monophosphate
+
−
** Ins3P
+
−
** 1L-myo-inositol 1-phosphate
+
−
** myo-inositol phosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN-11480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN-11479]]
−
* [[RXN66-579]]
+
−
* [[RXN-10960]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 3-oxo-pimeloyl-[acp] methyl ester}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288700 5288700]
+
{{#set: common name=a 3-ketopimelyl-[acp] methyl ester|a 3-ketopimeloyl-[acyl-carrier protein] methyl ester|a 3-oxo-pimelyl-[acp] methyl ester|a 3-ketopimeloyl-[acp] methyl ester}}
−
* HMDB : HMDB06814
+
{{#set: consumed by=RXN-11480}}
−
* LIGAND-CPD:
+
{{#set: produced by=RXN-11479}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04006 C04006]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.16744087.html 16744087]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58401 58401]
+
−
* METABOLIGHTS : MTBLC58401
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L}}
+
−
{{#set: common name=1D-myo-inositol 3-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=1-L-myo-inositol-1-p|L-myo-inositol 1-phosphate|inositol 1-phosphate|myo-inositol 1-phosphate|1D-myo-inositol 3-phosphate|Ins(3)P1|D-myo-inositol (3)-monophosphate|myo-inositol 1-monophosphate|Ins3P|1L-myo-inositol 1-phosphate|myo-inositol phosphate}}
+
−
{{#set: consumed by=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN}}
+
−
{{#set: produced by=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579|RXN-10960}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite 3-Ketopimeloyl-ACP-methyl-esters

  • common name:
    • a 3-oxo-pimeloyl-[acp] methyl ester
  • Synonym(s):
    • a 3-ketopimelyl-[acp] methyl ester
    • a 3-ketopimeloyl-[acyl-carrier protein] methyl ester
    • a 3-oxo-pimelyl-[acp] methyl ester
    • a 3-ketopimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-pimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-oxo-pimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketopimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-Ketopimeloyl-ACP-methyl-esters&oldid=48113"