Difference between revisions of "CPD-1108"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == * common name: ** a 1-phosphatidyl-1D-myo-inositol 4-phosphate * Synonym(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 1-phosphatidyl-1D-myo-inositol 4-phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phosphatidylinositol-4-phosphate |
| − | ** | + | ** PtdIns4P |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13334]] |
| − | * [[ | + | * [[2.7.1.68-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 1-phosphatidyl-1D-myo-inositol 4-phosphate}} | |
| − | + | {{#set: common name=phosphatidylinositol-4-phosphate|PtdIns4P}} | |
| − | + | {{#set: consumed by=RXN-13334|2.7.1.68-RXN}} | |
| − | + | {{#set: produced by=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-1108
- common name:
- a 1-phosphatidyl-1D-myo-inositol 4-phosphate
- Synonym(s):
- phosphatidylinositol-4-phosphate
- PtdIns4P
