Difference between revisions of "CPD-17894"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9531 == * left end position: ** 3645 * transcription direction: ** NEGATIVE * right end position: ** 5385 * centisome position: ** 39.35435...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9531 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
* left end position:
+
* smiles:
** 3645
+
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
* transcription direction:
+
* common name:
** NEGATIVE
+
** β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
* right end position:
+
* inchi key:
** 5385
+
** InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
* centisome position:
+
* molecular weight:
** 39.35435    
+
** 1012.461    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-16602]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3645}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820528 91820528]
{{#set: right end position=5385}}
+
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C}}
{{#set: centisome position=39.35435   }}
+
{{#set: common name=β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)}}
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: inchi key=InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M}}
 +
{{#set: molecular weight=1012.461   }}
 +
{{#set: produced by=RXN-16602}}

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-17894

  • smiles:
    • CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
  • common name:
    • β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
  • inchi key:
    • InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
  • molecular weight:
    • 1012.461
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C" cannot be used as a page name in this wiki.