Difference between revisions of "RXN-7607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] == * direction: ** LEFT-TO-RIGHT * common name: ** 5_-nucleotidase ** 5_deoxy_cy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N
+
 
* common name:
 
* common name:
−
** echinenone
+
** 5_-nucleotidase
−
* molecular weight:
+
** 5_deoxy_cytosolic_type_c_protein
−
** 550.866   
+
** probable_cytosolic_imp-gmp_specific_5_-nucleotidase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.3.99 EC-3.1.3.99]
 +
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R07562]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[IMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[INOSINE]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 IMP[c] '''+''' 1 H2O[c] '''=>''' 1 inosine[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6988]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5911]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_14246]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13929]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_6640]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14434]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14435]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR01070060
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27718 27718]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281236 5281236]
+
* LIGAND-RXN:
−
* CHEMSPIDER:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01126 R01126]
−
** [http://www.chemspider.com/Chemical-Structure.4444648.html 4444648]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: common name=5_-nucleotidase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4746 4746]
+
{{#set: common name=5_deoxy_cytosolic_type_c_protein}}
−
* LIGAND-CPD:
+
{{#set: common name=probable_cytosolic_imp-gmp_specific_5_-nucleotidase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08592 C08592]
+
{{#set: common name=ORF}}
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
+
{{#set: ec number=EC-3.1.3.99}}
−
{{#set: inchi key=InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N}}
+
{{#set: ec number=EC-3.1.3.5}}
−
{{#set: common name=echinenone}}
+
{{#set: gene associated=Tiso_gene_6988|Tiso_gene_5911|Tiso_gene_14246|Tiso_gene_13929|Tiso_gene_6640|Tiso_gene_14434|Tiso_gene_14435}}
−
{{#set: molecular weight=550.866    }}
+
{{#set: in pathway=PWY-6596}}
−
{{#set: consumed by=R07562}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 21:22, 21 March 2018

Reaction RXN-7607

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5_-nucleotidase
    • 5_deoxy_cytosolic_type_c_protein
    • probable_cytosolic_imp-gmp_specific_5_-nucleotidase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 IMP[c] + 1 H2O[c] => 1 inosine[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6596, adenosine nucleotides degradation I: PWY-6596
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links







Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7607&oldid=48157"