Difference between revisions of "CPD-17346"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19432 == * left end position: ** 1491 * transcription direction: ** POSITIVE * right end position: ** 2327 * centisome position: ** 64.0188...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1067.974 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16095]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16094]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581045 71581045] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74012 74012] |
| − | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| + | {{#set: common name=3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J}} | ||
| + | {{#set: molecular weight=1067.974 }} | ||
| + | {{#set: consumed by=RXN-16095}} | ||
| + | {{#set: produced by=RXN-16094}} | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-17346
- smiles:
- CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA
- inchi key:
- InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J
- molecular weight:
- 1067.974
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
