Difference between revisions of "Tiso gene 5022"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
(Created page with "Category:Gene == Gene Tiso_gene_5022 == * right end position: ** 4811 * transcription direction: ** NEGATIVE * left end position: ** 718 * centisome position: ** 3.7029397...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Gene Tiso_gene_5022 ==
−
* smiles:
+
* right end position:
−
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
+
** 4811
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** serotonin O-sulfate
+
** 718
−
* molecular weight:
+
* centisome position:
−
** 256.276    
+
** 3.7029397    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxytryptamine O-sulfate
 
−
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 
−
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-10777]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4811}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=718}}
−
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
+
{{#set: centisome position=3.7029397   }}
−
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
+
−
{{#set: common name=serotonin O-sulfate}}
+
−
{{#set: molecular weight=256.276   }}
+
−
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
+
−
{{#set: produced by=RXN-10777}}
+

Latest revision as of 20:22, 21 March 2018

Gene Tiso_gene_5022

  • right end position:
    • 4811
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 718
  • centisome position:
    • 3.7029397
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5022&oldid=48164"