Difference between revisions of "L-THYROXINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5036 == * left end position: ** 10277 * transcription direction: ** POSITIVE * right end position: ** 13522 * centisome position: ** 73.506...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == * smiles: ** C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) |
− | * | + | * common name: |
− | ** | + | ** L-thyroxine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 776.874 |
* Synonym(s): | * Synonym(s): | ||
+ | ** levothyroxine | ||
+ | ** 3,3',5,5'-tetraiodo-L-thyronine | ||
+ | ** 3,5,3',5'-tetraiodo-L-thyronine | ||
+ | ** 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine | ||
+ | ** levothyroxin | ||
+ | ** O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine | ||
+ | ** T4 | ||
+ | ** L-T4 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10614]] |
− | * | + | * [[RXN-10606]] |
− | * | + | * [[RXN-10608]] |
− | == | + | * [[THYROXINE-DEIODINASE-RXN]] |
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 51-48-9 |
− | {{#set: | + | * DRUGBANK : DB00451 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201348 25201348] |
− | {{#set: | + | * HMDB : HMDB00248 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01829 C01829] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5614.html 5614] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58448 58448] | ||
+ | * METABOLIGHTS : MTBLC18332 | ||
+ | {{#set: smiles=C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | ||
+ | {{#set: common name=L-thyroxine}} | ||
+ | {{#set: inchi key=InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N}} | ||
+ | {{#set: molecular weight=776.874 }} | ||
+ | {{#set: common name=levothyroxine|3,3',5,5'-tetraiodo-L-thyronine|3,5,3',5'-tetraiodo-L-thyronine|4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine|levothyroxin|O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine|T4|L-T4}} | ||
+ | {{#set: consumed by=RXN-10614|RXN-10606|RXN-10608|THYROXINE-DEIODINASE-RXN}} |
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite L-THYROXINE
- smiles:
- C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
- common name:
- L-thyroxine
- inchi key:
- InChIKey=XUIIKFGFIJCVMT-LBPRGKRZSA-N
- molecular weight:
- 776.874
- Synonym(s):
- levothyroxine
- 3,3',5,5'-tetraiodo-L-thyronine
- 3,5,3',5'-tetraiodo-L-thyronine
- 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine
- levothyroxin
- O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine
- T4
- L-T4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-48-9
- DRUGBANK : DB00451
- PUBCHEM:
- HMDB : HMDB00248
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18332
"C(=O)([O-])C([N+])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.