Difference between revisions of "CPD-15676"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14024 RXN-14024] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** ORF
+
** 6-trans-3-oxo-tridecenoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J
 +
* molecular weight:
 +
** 971.802   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6E-3-oxo-tridecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-14788]]
** 1 [[Nucleoside-Triphosphates]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c] '''+''' 1 [[Nucleoside-Monophosphates]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a nucleoside triphosphate[c] '''+''' 2 H2O[c] '''=>''' 2 H+[c] '''+''' 2 phosphate[c] '''+''' 1 a nucleoside 5'-monophosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_13653]]
+
** EXPERIMENTAL_ANNOTATION
+
***AUTOMATED-NAME-MATCH
+
* [[Tiso_gene_12899]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_20236]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=ORF}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657406 90657406]
{{#set: ec number=EC-3.6.1.5}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: gene associated=Tiso_gene_13653|Tiso_gene_12899|Tiso_gene_20236}}
+
{{#set: common name=6-trans-3-oxo-tridecenoyl-CoA}}
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J}}
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=971.802    }}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=6E-3-oxo-tridecenoyl-CoA}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: consumed by=RXN-14788}}
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-15676

  • smiles:
    • CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 6-trans-3-oxo-tridecenoyl-CoA
  • inchi key:
    • InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J
  • molecular weight:
    • 971.802
  • Synonym(s):
    • 6E-3-oxo-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.