Difference between revisions of "CPD-15676"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5272 == * left end position: ** 2490 * transcription direction: ** POSITIVE * right end position: ** 5636 * centisome position: ** 18.18314...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** 6-trans-3-oxo-tridecenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 971.802 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6E-3-oxo-tridecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-14788]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657406 90657406] |
− | {{#set: | + | {{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: common name=6-trans-3-oxo-tridecenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J}} |
+ | {{#set: molecular weight=971.802 }} | ||
+ | {{#set: common name=6E-3-oxo-tridecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14788}} |
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite CPD-15676
- smiles:
- CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 6-trans-3-oxo-tridecenoyl-CoA
- inchi key:
- InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J
- molecular weight:
- 971.802
- Synonym(s):
- 6E-3-oxo-tridecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.