Difference between revisions of "RXN66-161"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-161 RXN66-161] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-161 RXN66-161] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
−
* common name:
+
−
** OPC4-trans-2-enoyl-CoA
+
−
* molecular weight:
+
−
** 981.797   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10705]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-2742]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-2750]][c] '''+''' 1 [[WATER]][c]
−
* [[RXN-10707]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 cotinine[c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 trans-3'-hydroxycotinine[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1035]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
 +
** '''5''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329]
+
{{#set: ec number=EC-1.14.14.1}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: gene associated=Tiso_gene_1035}}
−
{{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}}
+
{{#set: in pathway=PWY66-221}}
−
{{#set: common name=OPC4-trans-2-enoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=981.797    }}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: consumed by=RXN-10705}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: produced by=RXN-10707}}
+

Latest revision as of 20:22, 21 March 2018

Reaction RXN66-161

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-221, nicotine degradation V: PWY66-221
    • 5 reactions found over 18 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-161&oldid=48185"