Difference between revisions of "Tiso gene 7305"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_7305 == * right end position: ** 11083 * transcription direction: ** NEGATIVE * left end position: ** 4066 * centisome position: ** 35.8870...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7305 == |
− | * | + | * right end position: |
− | ** | + | ** 11083 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 4066 |
− | * | + | * centisome position: |
− | ** | + | ** 35.887028 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[FARNESYLTRANSTRANSFERASE-RXN]] |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-7736]] |
− | * [[ | + | * [[PWY-7492]] |
+ | * [[PWY-6659]] | ||
+ | * [[PWY-6691]] | ||
+ | * [[PWY-5120]] | ||
+ | * [[PWY-7517]] | ||
+ | * [[PWY-7721]] | ||
+ | * [[PWY-7720]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11083}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=4066}} | |
− | + | {{#set: centisome position=35.887028 }} | |
− | + | {{#set: reaction associated=FARNESYLTRANSTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-7492|PWY-6659|PWY-6691|PWY-5120|PWY-7517|PWY-7721|PWY-7720}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:22, 21 March 2018
Gene Tiso_gene_7305
- right end position:
- 11083
- transcription direction:
- NEGATIVE
- left end position:
- 4066
- centisome position:
- 35.887028
- Synonym(s):
Reactions associated
- Reaction: FARNESYLTRANSTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation