Difference between revisions of "HOMOACONITATE-HYDRATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOACONITATE-HYDRATASE-RXN HOMOACONITATE-HYDRATASE-RXN] == * direction: ** REVERSIBLE * ec number:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOACONITATE-HYDRATASE-RXN HOMOACONITATE-HYDRATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.36 EC-4.2.1.36] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[HOMO-I-CIT]][c] '''<=>''' 1 [[HOMO-CIS-ACONITATE]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (1R,2S)-homoisocitrate[c] '''<=>''' 1 cis-homoaconitate[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12778]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-3081]], L-lysine biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3081 PWY-3081] | ||
+ | ** '''2''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[P241-PWY]], coenzyme B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=P241-PWY P241-PWY] | ||
+ | ** '''1''' reactions found over '''16''' reactions in the full pathway | ||
+ | * [[LYSINE-AMINOAD-PWY]], L-lysine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-AMINOAD-PWY LYSINE-AMINOAD-PWY] | ||
+ | ** '''3''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15485 15485] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04371 R04371] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58409 Q58409] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49367 P49367] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9UT74 Q9UT74] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.36}} |
+ | {{#set: gene associated=Tiso_gene_12778}} | ||
+ | {{#set: in pathway=PWY-3081|P241-PWY|LYSINE-AMINOAD-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:22, 21 March 2018
Contents
Reaction HOMOACONITATE-HYDRATASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 HOMO-I-CIT[c] <=> 1 HOMO-CIS-ACONITATE[c] + 1 WATER[c]
- With common name(s):
- 1 (1R,2S)-homoisocitrate[c] <=> 1 cis-homoaconitate[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12778
- Source: orthology-esiliculosus
Pathways
- PWY-3081, L-lysine biosynthesis V: PWY-3081
- 2 reactions found over 10 reactions in the full pathway
- P241-PWY, coenzyme B biosynthesis: P241-PWY
- 1 reactions found over 16 reactions in the full pathway
- LYSINE-AMINOAD-PWY, L-lysine biosynthesis IV: LYSINE-AMINOAD-PWY
- 3 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links