Difference between revisions of "CPD-13754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12685 == * left end position: ** 1155 * transcription direction: ** POSITIVE * right end position: ** 2656 * centisome position: ** 17.0379...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12685 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] ==
* left end position:
+
* smiles:
** 1155
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
* right end position:
+
* inchi key:
** 2656
+
** InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J
* centisome position:
+
* molecular weight:
** 17.037912    
+
** 983.77    
 
* Synonym(s):
 
* Synonym(s):
 +
** HIP-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[RXN-12747]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-6386]]
+
* [[PWY-6387]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1155}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289539 86289539]
{{#set: right end position=2656}}
+
* CHEBI:
{{#set: centisome position=17.037912   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78357 78357]
{{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
{{#set: pathway associated=PWY-6386|PWY-6387}}
+
{{#set: common name=3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
 +
{{#set: inchi key=InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J}}
 +
{{#set: molecular weight=983.77   }}
 +
{{#set: common name=HIP-CoA}}
 +
{{#set: consumed by=RXN-12747}}

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-13754

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
  • common name:
    • 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
  • inchi key:
    • InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J
  • molecular weight:
    • 983.77
  • Synonym(s):
    • HIP-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-" cannot be used as a page name in this wiki.
"3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA" cannot be used as a page name in this wiki.