Difference between revisions of "CPD-7005"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15900 == * left end position: ** 147 * transcription direction: ** POSITIVE * right end position: ** 347 * centisome position: ** 3.1163876...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15900 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
−
* left end position:
+
* smiles:
−
** 147
+
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** geranylgeranyl chlorophyll a
−
* right end position:
+
* inchi key:
−
** 347
+
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
−
* centisome position:
+
* molecular weight:
−
** 3.1163876    
+
** 886.447    
 
* Synonym(s):
 
* Synonym(s):
 +
** geranylgeranyl-chl a
 +
** GG-chl a
 +
** GG-chlorophyll a
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* [[RXN-7664]]
−
** in-silico_annotation
+
* [[RXN-17428]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[athaliana]]
+
* [[RXN-7663]]
−
** [[pantograph]]-[[synechocystis]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways associated ==
+
−
* [[PWY0-1415]]
+
−
* [[HEMESYN2-PWY]]
+
−
* [[HEME-BIOSYNTHESIS-II]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=147}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
−
{{#set: right end position=347}}
+
* CHEBI:
−
{{#set: centisome position=3.1163876   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
−
{{#set: reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
−
{{#set: pathway associated=PWY0-1415|HEMESYN2-PWY|HEME-BIOSYNTHESIS-II}}
+
{{#set: common name=geranylgeranyl chlorophyll a}}
 +
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
 +
{{#set: molecular weight=886.447   }}
 +
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
 +
{{#set: consumed by=RXN-7664|RXN-17428}}
 +
{{#set: produced by=RXN-7663}}

Latest revision as of 20:22, 21 March 2018

Metabolite CPD-7005

  • smiles:
    • C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
  • common name:
    • geranylgeranyl chlorophyll a
  • inchi key:
    • InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
  • molecular weight:
    • 886.447
  • Synonym(s):
    • geranylgeranyl-chl a
    • GG-chl a
    • GG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7005&oldid=48231"