Difference between revisions of "BENZENE-NO2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * common name: ** nitroben...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C1(=CC=C(C=C1)[N+]([O-])=O) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** nitrobenzene |
| + | * inchi key: | ||
| + | ** InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 123.111 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** benzene-NO2 |
| + | ** nitro-benzene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-3661]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 98-95-3 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7416 7416] |
| + | * HMDB : HMDB41950 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06813 C06813] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.7138.html 7138] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27798 27798] |
| − | + | {{#set: smiles=C1(=CC=C(C=C1)[N+]([O-])=O)}} | |
| − | {{#set: smiles=C( | + | {{#set: common name=nitrobenzene}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=123.111 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=benzene-NO2|nitro-benzene}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-3661}} |
| − | {{#set: | + | |
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite BENZENE-NO2
- smiles:
- C1(=CC=C(C=C1)[N+]([O-])=O)
- common name:
- nitrobenzene
- inchi key:
- InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N
- molecular weight:
- 123.111
- Synonym(s):
- benzene-NO2
- nitro-benzene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC=C(C=C1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
