Difference between revisions of "TARTRONATE-S-ALD"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMCL AMCL] == * direction: ** LEFT-TO-RIGHT * common name: ** S-adenosyl-L-methionine carboxy-lyase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == * smiles: ** [CH](=O)C(O)C(=O)[O-] * common name: ** tart...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)C(O)C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** tartronate semialdehyde |
+ | * inchi key: | ||
+ | ** InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 103.054 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-hydroxy-3-oxopropanoate | ||
+ | ** tartronic semialdehyde | ||
+ | ** hydroxymalonaldehydic acid | ||
+ | ** tartronate-S-ald | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[R01747]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-5289]] | |
− | + | * [[RXN0-305]] | |
− | == | + | * [[4.1.2.20-RXN]] |
− | + | * [[KDGALDOL-RXN]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2480-77-5 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22134427 22134427] |
− | {{#set: | + | * HMDB : HMDB06938 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01146 C01146] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57978 57978] | ||
+ | * BIGG : 2h3oppan | ||
+ | {{#set: smiles=[CH](=O)C(O)C(=O)[O-]}} | ||
+ | {{#set: common name=tartronate semialdehyde}} | ||
+ | {{#set: inchi key=InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=103.054 }} | ||
+ | {{#set: common name=2-hydroxy-3-oxopropanoate|tartronic semialdehyde|hydroxymalonaldehydic acid|tartronate-S-ald}} | ||
+ | {{#set: consumed by=R01747}} | ||
+ | {{#set: reversible reaction associated=RXN0-5289|RXN0-305|4.1.2.20-RXN|KDGALDOL-RXN}} |
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite TARTRONATE-S-ALD
- smiles:
- [CH](=O)C(O)C(=O)[O-]
- common name:
- tartronate semialdehyde
- inchi key:
- InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M
- molecular weight:
- 103.054
- Synonym(s):
- 2-hydroxy-3-oxopropanoate
- tartronic semialdehyde
- hydroxymalonaldehydic acid
- tartronate-S-ald
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.