Difference between revisions of "L-RIBULOSE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-GLU-AMINOTRANSFERASE-RXN ORNITHINE-GLU-AMINOTRANSFERASE-RXN] == * direction: ** REVERSIBL...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * common name...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-GLU-AMINOTRANSFERASE-RXN ORNITHINE-GLU-AMINOTRANSFERASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
 
* common name:
 
* common name:
−
** Ornithine--oxo-glutarate aminotransferase
+
** L-ribulose 5-phosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.6.1.13 EC-2.6.1.13]
+
** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-ribulose-5-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-ORNITHINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[L-GLUTAMATE_GAMMA-SEMIALDEHYDE]][c]
+
* [[RXN0-5116]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-ornithine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 L-glutamate-5-semialdehyde[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11231]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[ARGASEDEG-PWY]], L-arginine degradation I (arginase pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARGASEDEG-PWY ARGASEDEG-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6922]], L-N&delta;-acetylornithine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922]
+
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6344]], L-ornithine degradation II (Stickland reaction): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344]
+
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-3341]], L-proline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3341 PWY-3341]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[ARG-PRO-PWY]], L-arginine degradation VI (arginase 2 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-4981]], L-proline biosynthesis II (from arginine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4981 PWY-4981]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[ARGININE-SYN4-PWY]], L-ornithine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=ARGININE-SYN4-PWY ARGININE-SYN4-PWY]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY]
+
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 2922-69-2
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25160 25160]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00667 R00667]
+
* LIGAND-CPD:
−
{{#set: direction=REVERSIBLE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101]
−
{{#set: common name=Ornithine--oxo-glutarate aminotransferase}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-2.6.1.13}}
+
** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750]
−
{{#set: gene associated=Tiso_gene_11231}}
+
* CHEBI:
−
{{#set: in pathway=ARGASEDEG-PWY|PWY-6922|PWY-6344|PWY-3341|ARG-PRO-PWY|PWY-4981|ARGININE-SYN4-PWY|CITRULBIO-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : ru5p__L
−
{{#set: reconstruction source=orthology-synechocystis}}
+
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=L-ribulose 5-phosphate}}
 +
{{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=L-ribulose-5-P}}
 +
{{#set: produced by=RXN0-5116}}

Latest revision as of 20:22, 21 March 2018

Metabolite L-RIBULOSE-5-P

  • smiles:
    • C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
  • common name:
    • L-ribulose 5-phosphate
  • inchi key:
    • InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • L-ribulose-5-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-RIBULOSE-5-P&oldid=48273"