Difference between revisions of "CPD-13014"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOx NODOx] == * direction: ** LEFT-TO-RIGHT * common name: ** nitric oxide, NADH2:oxygen oxidored...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * common name: ** tributy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == |
− | * | + | * smiles: |
− | ** | + | ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O |
* common name: | * common name: | ||
− | ** | + | ** tributyrin |
+ | * inchi key: | ||
+ | ** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 302.367 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** butyryl triglyceride | ||
+ | ** butanoic acid, 1,2,3-propanetriyl ester | ||
+ | ** 1,2,3-tributyrylglycerol | ||
+ | ** tributin | ||
+ | ** tributyrinine | ||
+ | ** glycerol tributyrate | ||
+ | ** glyceryl tributyrate | ||
+ | ** butyrin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12086]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665] |
− | {{#set: | + | * HMDB : HMDB31094 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050] | ||
+ | {{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}} | ||
+ | {{#set: common name=tributyrin}} | ||
+ | {{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=302.367 }} | ||
+ | {{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}} | ||
+ | {{#set: consumed by=RXN-12086}} |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite CPD-13014
- smiles:
- CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
- common name:
- tributyrin
- inchi key:
- InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
- molecular weight:
- 302.367
- Synonym(s):
- butyryl triglyceride
- butanoic acid, 1,2,3-propanetriyl ester
- 1,2,3-tributyrylglycerol
- tributin
- tributyrinine
- glycerol tributyrate
- glyceryl tributyrate
- butyrin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links