Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3756 == * Synonym(s): == Reactions associated == * AMETt2h ** pantograph-creinhardtii * AMETt2m ** pantograph-creinh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == * smiles:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3) | ||
+ | * common name: | ||
+ | ** vitamin K 2,3-epoxide | ||
+ | * inchi key: | ||
+ | ** InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N | ||
+ | * molecular weight: | ||
+ | ** 466.703 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,3-epoxyphylloquinone | ||
+ | ** 2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[1.1.4.1-RXN]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460204 5460204] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444391.html 4444391] | ||
+ | * HMDB : HMDB02972 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15759 15759] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05849 C05849] | ||
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3)}} | ||
+ | {{#set: common name=vitamin K 2,3-epoxide}} | ||
+ | {{#set: inchi key=InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N}} | ||
+ | {{#set: molecular weight=466.703 }} | ||
+ | {{#set: common name=2,3-epoxyphylloquinone|2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone}} | ||
+ | {{#set: reversible reaction associated=1.1.4.1-RXN}} |
Latest revision as of 21:23, 21 March 2018
Contents
Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3)
- common name:
- vitamin K 2,3-epoxide
- inchi key:
- InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N
- molecular weight:
- 466.703
- Synonym(s):
- 2,3-epoxyphylloquinone
- 2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links