Difference between revisions of "Tiso gene 6635"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Gene == Gene Tiso_gene_6635 == * right end position: ** 8209 * transcription direction: ** POSITIVE * left end position: ** 5636 * centisome position: ** 47.07651...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6635 == |
− | * | + | * right end position: |
− | ** | + | ** 8209 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5636 |
− | * | + | * centisome position: |
− | ** | + | ** 47.07651 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-6386]] | ||
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8209}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5636}} | |
− | + | {{#set: centisome position=47.07651 }} | |
− | + | {{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=PWY-6386|PWY-6387}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:23, 21 March 2018
Gene Tiso_gene_6635
- right end position:
- 8209
- transcription direction:
- POSITIVE
- left end position:
- 5636
- centisome position:
- 47.07651
- Synonym(s):
Reactions associated
- Reaction: UDPNACETYLMURAMATEDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation