Difference between revisions of "Ribulose-phosphates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribulose-phosphates Ribulose-phosphates] == * common name: ** L(or D)-ribulose 5-phosphate * Sy...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribulose-phosphates Ribulose-phosphates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** L- | + | ** L(or D)-ribulose 5-phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RIBULOKIN-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=L(or D)-ribulose 5-phosphate}} | |
| − | + | {{#set: reversible reaction associated=RIBULOKIN-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name=L- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite Ribulose-phosphates
- common name:
- L(or D)-ribulose 5-phosphate
- Synonym(s):
