Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutaminyl-Protein N-Ac-L-methionyl-L-glutaminyl-Protein] == * common name:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutaminyl-Protein N-Ac-L-methionyl-L-glutaminyl-Protein] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
+
−
* inchi key:
+
−
** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
+
 
* common name:
 
* common name:
−
** L-ribulose 5-phosphate
+
** an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein]
−
* molecular weight:
+
−
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-ribulose-5-P
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17893]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-5116]]
+
* [[RXN-17851]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 2922-69-2
+
{{#set: common name=an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein]}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-17893}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006]
+
{{#set: produced by=RXN-17851}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226]
+
−
* BIGG : ru5p__L
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}}
+
−
{{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}}
+
−
{{#set: common name=L-ribulose 5-phosphate}}
+
−
{{#set: molecular weight=228.095    }}
+
−
{{#set: common name=L-ribulose-5-P}}
+
−
{{#set: produced by=RXN0-5116}}
+

Latest revision as of 20:23, 21 March 2018

Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein

  • common name:
    • an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Ac-L-methionyl-L-glutaminyl-Protein&oldid=48314"