Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutaminyl-Protein N-Ac-L-methionyl-L-glutaminyl-Protein] == * common name:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutaminyl-Protein N-Ac-L-methionyl-L-glutaminyl-Protein] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17893]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17851]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein]}} | |
− | + | {{#set: consumed by=RXN-17893}} | |
− | + | {{#set: produced by=RXN-17851}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: produced by= | + |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein
- common name:
- an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein" cannot be used as a page name in this wiki.