Difference between revisions of "LYS"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8938 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * common name: ** L-lysine * inchi key: **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == |
| + | * smiles: | ||
| + | ** C([N+])CCCC([N+])C([O-])=O | ||
| + | * common name: | ||
| + | ** L-lysine | ||
| + | * inchi key: | ||
| + | ** InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O | ||
| + | * molecular weight: | ||
| + | ** 147.197 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** K | ||
| + | ** lysine | ||
| + | ** L-lys | ||
| + | ** lys | ||
| + | ** 2,6-diaminohexanoic acid | ||
| + | ** lysine acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RME144]] |
| − | ** [[ | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
| − | == | + | * [[LYSDECARBOX-RXN]] |
| + | * [[1.5.1.8-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.7-RXN]] | ||
| + | * [[DIAMINOPIMDECARB-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 56-87-1 |
| + | * BIGG : lys__L | ||
| + | * BIGG : 33655 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460926 5460926] | ||
| + | * HMDB : HMDB00182 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00047 C00047] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5747.html 5747] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32551 32551] | ||
| + | * METABOLIGHTS : MTBLC32551 | ||
| + | {{#set: smiles=C([N+])CCCC([N+])C([O-])=O}} | ||
| + | {{#set: common name=L-lysine}} | ||
| + | {{#set: inchi key=InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O}} | ||
| + | {{#set: molecular weight=147.197 }} | ||
| + | {{#set: common name=K|lysine|L-lys|lys|2,6-diaminohexanoic acid|lysine acid}} | ||
| + | {{#set: consumed by=RME144|LYSINE--TRNA-LIGASE-RXN|LYSDECARBOX-RXN|1.5.1.8-RXN}} | ||
| + | {{#set: produced by=1.5.1.7-RXN|DIAMINOPIMDECARB-RXN}} | ||
Latest revision as of 21:23, 21 March 2018
Contents
Metabolite LYS
- smiles:
- C([N+])CCCC([N+])C([O-])=O
- common name:
- L-lysine
- inchi key:
- InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O
- molecular weight:
- 147.197
- Synonym(s):
- K
- lysine
- L-lys
- lys
- 2,6-diaminohexanoic acid
- lysine acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-87-1
- BIGG : lys__L
- BIGG : 33655
- PUBCHEM:
- HMDB : HMDB00182
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32551
"C([N+])CCCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
