Difference between revisions of "Tiso gene 7953"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7953 == * right end position: ** 10584 * transcription direction: ** POSITIVE * left end position: ** 7945 * centisome position: ** 74.4611...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
+
== Gene Tiso_gene_7953 ==
−
* smiles:
+
* right end position:
−
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
+
** 10584
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** prephytoene diphosphate
+
** 7945
−
* molecular weight:
+
* centisome position:
−
** 719.897    
+
** 74.461105    
 
* Synonym(s):
 
* Synonym(s):
−
** (1R,2R,3R)-prephytoene diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNARA-8002]]
+
* Reaction: [[RXN-6883]]
−
* [[RXN-12245]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: automated-name-match
−
* [[2.5.1.32-RXN]]
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10584}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=7945}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
+
{{#set: centisome position=74.461105   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-6883}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
+
{{#set: pathway associated=PWY-4302}}
−
* HMDB : HMDB03023
+
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K}}
+
−
{{#set: common name=prephytoene diphosphate}}
+
−
{{#set: molecular weight=719.897   }}
+
−
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
+
−
{{#set: consumed by=RXNARA-8002|RXN-12245}}
+
−
{{#set: produced by=2.5.1.32-RXN}}
+

Latest revision as of 21:23, 21 March 2018

Gene Tiso_gene_7953

  • right end position:
    • 10584
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7945
  • centisome position:
    • 74.461105
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7953&oldid=48338"