Difference between revisions of "Reduced-Factor-F420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-Factor-F420 Reduced-Factor-F420] == * common name: ** a reduced coenzyme F420 * Synonym...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-Factor-F420 Reduced-Factor-F420] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a reduced coenzyme F420 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** a reduced cofactor F420 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[COENZYME-F420-HYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a reduced coenzyme F420}} | |
| − | + | {{#set: common name=a reduced cofactor F420}} | |
| − | + | {{#set: reversible reaction associated=COENZYME-F420-HYDROGENASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 21:23, 21 March 2018
Contents
Metabolite Reduced-Factor-F420
- common name:
- a reduced coenzyme F420
- Synonym(s):
- a reduced cofactor F420
