Difference between revisions of "RXN-775"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] ==
−
* smiles:
+
* direction:
−
** C1(NC=NC=1CC(C(=O)[O-])[N+])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N
+
** [http://enzyme.expasy.org/EC/1.1 EC-1.1]
−
* common name:
+
−
** L-histidine
+
−
* molecular weight:
+
−
** 155.156   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glyoxaline-5-alanine
 
−
** α-amino-4-imidazoleproprionic acid
 
−
** (S)-α-amino-1H-imidazole-4-propanoic acid
 
−
** H
 
−
** histidine
 
−
** his
 
−
** L-his
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RME144]]
+
* With identifiers:
−
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
** 1 [[Acceptor]][c] '''+''' 1 [[CPD-715]][c] '''=>''' 1 [[CPD-717]][c] '''+''' 1 [[Donor-H2]][c]
−
* [[CARNOSINE-SYNTHASE-RXN]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 an oxidized electron acceptor[c] '''+''' 1 6-deoxoteasterone[c] '''=>''' 1 3-dehydro-6-deoxoteasterone[c] '''+''' 1 a reduced electron acceptor[c]
−
* [[RXN-8001]]
+
 
−
* [[HISTALDEHYD-RXN]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3577]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2582]], brassinosteroid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582]
 +
** '''7''' reactions found over '''21''' reactions in the full pathway
 +
* [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699]
 +
** '''11''' reactions found over '''25''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 71-00-1
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC57595
+
** [http://www.genome.jp/dbget-bin/www_bget?R07449 R07449]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971009 6971009]
+
{{#set: ec number=EC-1.1}}
−
* HMDB : HMDB00177
+
{{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-2582|PWY-699}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00135 C00135]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57595 57595]
+
{{#set: reconstruction tool=pantograph}}
−
* BIGG : his__L
+
−
{{#set: smiles=C1(NC=NC=1CC(C(=O)[O-])[N+])}}
+
−
{{#set: inchi key=InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N}}
+
−
{{#set: common name=L-histidine}}
+
−
{{#set: molecular weight=155.156    }}
+
−
{{#set: common name=glyoxaline-5-alanine|α-amino-4-imidazoleproprionic acid|(S)-α-amino-1H-imidazole-4-propanoic acid|H|histidine|his|L-his}}
+
−
{{#set: consumed by=RME144|HISTIDINE--TRNA-LIGASE-RXN|CARNOSINE-SYNTHASE-RXN}}
+
−
{{#set: produced by=RXN-8001|HISTALDEHYD-RXN}}
+

Latest revision as of 20:23, 21 March 2018

Reaction RXN-775

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron acceptor[c] + 1 6-deoxoteasterone[c] => 1 3-dehydro-6-deoxoteasterone[c] + 1 a reduced electron acceptor[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2582, brassinosteroid biosynthesis II: PWY-2582
    • 7 reactions found over 21 reactions in the full pathway
  • PWY-699, brassinosteroid biosynthesis I: PWY-699
    • 11 reactions found over 25 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-775&oldid=48404"