Difference between revisions of "CPD0-2121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMYL-GLX-TRNAS GLUTAMYL-GLX-TRNAS] == * common name: ** an L-glutamyl-[tRNAGlx] * Synonym(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == * smiles: ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == |
+ | * smiles: | ||
+ | ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** trans-hex-2-enoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J | ||
+ | * molecular weight: | ||
+ | ** 859.631 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** hexenoyl-CoA | ||
+ | ** (2E)-hexenoyl-CoA | ||
+ | ** trans-2-hexenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14278]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : hx2coa |
− | {{#set: | + | * LIPID_MAPS : LMFA07050019 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921640 52921640] | ||
+ | * HMDB : HMDB03944 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05271 C05271] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62077 62077] | ||
+ | * METABOLIGHTS : MTBLC28706 | ||
+ | {{#set: smiles=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=trans-hex-2-enoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J}} | ||
+ | {{#set: molecular weight=859.631 }} | ||
+ | {{#set: common name=hexenoyl-CoA|(2E)-hexenoyl-CoA|trans-2-hexenoyl-CoA}} | ||
+ | {{#set: reversible reaction associated=RXN-14278}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD0-2121
- smiles:
- CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- trans-hex-2-enoyl-CoA
- inchi key:
- InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J
- molecular weight:
- 859.631
- Synonym(s):
- hexenoyl-CoA
- (2E)-hexenoyl-CoA
- trans-2-hexenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : hx2coa
- LIPID_MAPS : LMFA07050019
- PUBCHEM:
- HMDB : HMDB03944
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28706
"CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.