Difference between revisions of "3-KETO-ADIPYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAMm ATAMm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:AMP phosphotransferase, mitocho...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAMm ATAMm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** ATP:AMP phosphotransferase, mitochondria
+
** 3-oxoadipyl-CoA
 +
* inchi key:
 +
** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
 +
* molecular weight:
 +
** 904.605   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-ketoadipyl-CoA
 +
** 3-keto-adipyl-coa
 +
** β-ketoadipyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[AMP]][m] '''+''' 1.0 [[ATP]][m] '''=>''' 2.0 [[ADP]][m]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN0-2044]]
** 1.0 AMP[m] '''+''' 1.0 ATP[m] '''=>''' 2.0 ADP[m]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_5837]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_5839]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=ATP:AMP phosphotransferase, mitochondria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578]
{{#set: gene associated=Tiso_gene_5837|Tiso_gene_5839}}
+
* HMDB : HMDB60378
{{#set: in pathway=}}
+
* CHEBI:
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348]
{{#set: reconstruction source=orthology-creinhardtii}}
+
* LIGAND-CPD:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: common name=3-oxoadipyl-CoA}}
 +
{{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}}
 +
{{#set: molecular weight=904.605    }}
 +
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}}
 +
{{#set: reversible reaction associated=RXN0-2044}}

Latest revision as of 21:24, 21 March 2018

Metabolite 3-KETO-ADIPYL-COA

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxoadipyl-CoA
  • inchi key:
    • InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
  • molecular weight:
    • 904.605
  • Synonym(s):
    • 3-ketoadipyl-CoA
    • 3-keto-adipyl-coa
    • β-ketoadipyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.