Difference between revisions of "CPD1F-139"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17450 == * Synonym(s): == Reactions associated == * 6.3.2.25-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == |
+ | * smiles: | ||
+ | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
+ | * common name: | ||
+ | ** gibberellin A1 | ||
+ | * inchi key: | ||
+ | ** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M | ||
+ | * molecular weight: | ||
+ | ** 347.387 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA1 | ||
+ | ** gibberellin 1 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-115]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859] | ||
+ | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: common name=gibberellin A1}} | ||
+ | {{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}} | ||
+ | {{#set: molecular weight=347.387 }} | ||
+ | {{#set: common name=GA1|gibberellin 1}} | ||
+ | {{#set: consumed by=RXN-115}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD1F-139
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A1
- inchi key:
- InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
- molecular weight:
- 347.387
- Synonym(s):
- GA1
- gibberellin 1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.