Difference between revisions of "CPD1F-139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10619 RXN-10619] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10619 RXN-10619] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** gibberellin A1
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
 +
* molecular weight:
 +
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA1
 +
** gibberellin 1
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-115]]
−
** 1 [[CPD-11404]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[CPD-11410]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3,3',5-triiodothyroacetate[c] '''+''' 1 UDP-α-D-glucuronate[c] '''=>''' 1 triiodothyroacetate ether glucuronide[c] '''+''' 1 H+[c] '''+''' 1 UDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14141]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14140]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
+
−
** '''11''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=exostosin_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506]
−
{{#set: ec number=EC-2.4.1.17}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14141|Tiso_gene_14140}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717]
−
{{#set: in pathway=PWY-6261}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=gibberellin A1}}
 +
{{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}}
 +
{{#set: molecular weight=347.387    }}
 +
{{#set: common name=GA1|gibberellin 1}}
 +
{{#set: consumed by=RXN-115}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD1F-139

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A1
  • inchi key:
    • InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA1
    • gibberellin 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-139&oldid=48456"