Difference between revisions of "CPD-717"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17857 RXN-17857] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17857 RXN-17857] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.bv EC-2.3.1.bv]
+
** 3-dehydro-6-deoxoteasterone
 +
* inchi key:
 +
** InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N
 +
* molecular weight:
 +
** 432.685   
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydro-deoxoteasterone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11535]]
−
** 1 [[L-methionyl-L-tryptophanyl-Protein]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[N-Ac-L-methionyl-L-tryptophanyl-Protein]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-775]]
−
** 1 an N-terminal-L-methionyl-L-tryptophanyl-[protein][c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 an N-terminal Nα-acetyl-L-methionyl-L-tryptophanyl-[protein][c] '''+''' 1 coenzyme A[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
+
−
** '''21''' reactions found over '''21''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMST01030125
−
{{#set: ec number=EC-2.3.1.bv}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-7800}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061345 16061345]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20710 20710]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15800 C15800]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=3-dehydro-6-deoxoteasterone}}
 +
{{#set: inchi key=InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N}}
 +
{{#set: molecular weight=432.685    }}
 +
{{#set: common name=dehydro-deoxoteasterone}}
 +
{{#set: consumed by=RXN-11535}}
 +
{{#set: produced by=RXN-775}}

Latest revision as of 21:24, 21 March 2018

Metabolite CPD-717

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 3-dehydro-6-deoxoteasterone
  • inchi key:
    • InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N
  • molecular weight:
    • 432.685
  • Synonym(s):
    • dehydro-deoxoteasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-717&oldid=48478"