Difference between revisions of "Tiso gene 18825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18825 == * right end position: ** 2100 * transcription direction: ** POSITIVE * left end position: ** 5 * centisome position: ** 0.18050541...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] ==
+
== Gene Tiso_gene_18825 ==
−
* smiles:
+
* right end position:
−
** C2(=NC1(=C(NC(N=C(N)1)=O)N2))
+
** 2100
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** isoguanine
+
** 5
−
* molecular weight:
+
* centisome position:
−
** 151.127    
+
** 0.18050541    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-oxoadenine
 
−
** 2-hydroxyadenine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-14903]]
−
* [[RXN-15139]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7008]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PROUT-PWY]]
 +
* [[PWY-6922]]
 +
* [[PWY-5737]]
 +
* [[PWY0-1544]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2100}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=5}}
−
** [http://www.chemspider.com/Chemical-Structure.69351.html 69351]
+
{{#set: centisome position=0.18050541   }}
−
* CHEBI:
+
{{#set: reaction associated=RXN-14903|RXN0-7008}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462]
+
{{#set: pathway associated=PROUT-PWY|PWY-6922|PWY-5737|PWY0-1544|CITRULBIO-PWY}}
−
* HMDB : HMDB00403
+
−
{{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}}
+
−
{{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}}
+
−
{{#set: common name=isoguanine}}
+
−
{{#set: molecular weight=151.127   }}
+
−
{{#set: common name=2-oxoadenine|2-hydroxyadenine}}
+
−
{{#set: produced by=RXN-15139}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_18825

  • right end position:
    • 2100
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5
  • centisome position:
    • 0.18050541
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18825&oldid=48505"