Difference between revisions of "2-ACETO-LACTATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGLCNACEPIM-RXN UDPGLCNACEPIM-RXN] == * direction: ** REVERSIBLE * common name: ** glycosyltransf...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * common name: ** (S)-2...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGLCNACEPIM-RXN UDPGLCNACEPIM-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)C(C)(O)C(=O)[O-]
 
* common name:
 
* common name:
−
** glycosyltransferase_family_protein_2
+
** (S)-2-acetolactate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/5.1.3.14 EC-5.1.3.14]
+
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
 +
* molecular weight:
 +
** 131.108   
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 +
** α-acetolactate
 +
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-6081]]
−
** 1 [[UDP-N-ACETYL-D-GLUCOSAMINE]][c] '''<=>''' 1 [[UDP-MANNAC]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[ACETOLACTSYN-RXN]]
−
** 1 UDP-N-acetyl-&alpha;-D-glucosamine[c] '''<=>''' 1 UDP-N-acetyl-&alpha;-D-mannosamine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[ACETOLACTREDUCTOISOM-RXN]]
−
== Genes associated with this reaction  ==
+
* [[RXN-14037]]
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1316]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7816]], poly(ribitol phosphate) wall teichoic acid biosynthesis II (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7816 PWY-7816]
+
−
** '''1''' reactions found over '''17''' reactions in the full pathway
+
−
* [[TEICHOICACID-PWY]], poly(glycerol phosphate) wall teichoic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TEICHOICACID-PWY TEICHOICACID-PWY]
+
−
** '''1''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-7815]], poly(ribitol phosphate) wall teichoic acid biosynthesis I (B. subtilis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7815 PWY-7815]
+
−
** '''1''' reactions found over '''15''' reactions in the full pathway
+
−
* [[PWY-7819]], poly(3-O-&beta;-D-glucopyranosyl-N-acetylgalactosamine 1-phosphate) wall teichoic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7819 PWY-7819]
+
−
** '''1''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-7335]], UDP-N-acetyl-&alpha;-D-mannosaminouronate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7335 PWY-7335]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17213 17213]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
−
* LIGAND-RXN:
+
* HMDB : HMDB06855
−
** [http://www.genome.jp/dbget-bin/www_bget?R00420 R00420]
+
* LIGAND-CPD:
−
* UNIPROT:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
−
** [http://www.uniprot.org/uniprot/Q9JWW9 Q9JWW9]
+
* CHEMSPIDER:
−
{{#set: direction=REVERSIBLE}}
+
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
−
{{#set: common name=glycosyltransferase_family_protein_2}}
+
* CHEBI:
−
{{#set: ec number=EC-5.1.3.14}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
−
{{#set: gene associated=Tiso_gene_1316}}
+
* BIGG : alac__S
−
{{#set: in pathway=PWY-7816|TEICHOICACID-PWY|PWY-7815|PWY-7819|PWY-7335}}
+
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=(S)-2-acetolactate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=131.108    }}
 +
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|&alpha;-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
 +
{{#set: consumed by=RXN-6081}}
 +
{{#set: produced by=ACETOLACTSYN-RXN}}
 +
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}

Latest revision as of 20:24, 21 March 2018

Metabolite 2-ACETO-LACTATE

  • smiles:
    • CC(=O)C(C)(O)C(=O)[O-]
  • common name:
    • (S)-2-acetolactate
  • inchi key:
    • InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
  • molecular weight:
    • 131.108
  • Synonym(s):
    • (S)-2-hydroxy-2-methyl-3-oxobutanoate
    • α-acetolactate
    • (2S)-2-hydroxy-2-methyl-3-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-ACETO-LACTATE&oldid=48507"