Difference between revisions of "Tiso gene 13200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Tiso_gene_13200 == * right end position: ** 12618 * transcription direction: ** POSITIVE * left end position: ** 10615 * centisome position: ** 83.28...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
+
== Gene Tiso_gene_13200 ==
−
* smiles:
+
* right end position:
−
** CC(=O)C(C)(O)C(=O)[O-]
+
** 12618
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-2-acetolactate
+
** 10615
−
* molecular weight:
+
* centisome position:
−
** 131.108    
+
** 83.28756    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 
−
** α-acetolactate
 
−
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-6081]]
+
* Reaction: [[RXN0-4261]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[ACETOLACTSYN-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[ACETOLACTREDUCTOISOM-RXN]]
+
−
* [[RXN-14037]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12618}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB06855
+
{{#set: left end position=10615}}
−
* LIGAND-CPD:
+
{{#set: centisome position=83.28756   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
+
{{#set: reaction associated=RXN0-4261}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
+
−
* BIGG : alac__S
+
−
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
+
−
{{#set: common name=(S)-2-acetolactate}}
+
−
{{#set: molecular weight=131.108   }}
+
−
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
+
−
{{#set: consumed by=RXN-6081}}
+
−
{{#set: produced by=ACETOLACTSYN-RXN}}
+
−
{{#set: consumed or produced by=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_13200

  • right end position:
    • 12618
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10615
  • centisome position:
    • 83.28756
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13200&oldid=48540"