Difference between revisions of "DEAMIDO-NAD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nicotinate adenine dinucleotide |
+ | * inchi key: | ||
+ | ** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 662.399 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Deamino-NAD+ |
+ | ** NaADN | ||
+ | ** deamido-NAD+ | ||
+ | ** deamidonicotinamide adenine dinucleoetide | ||
+ | ** deamido-NAD | ||
+ | ** NAAD | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DNNH]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 6450-77-7 | ||
+ | * DRUGBANK : DB04099 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646] |
+ | * HMDB : HMDB01179 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437] |
− | {{#set: smiles= | + | * BIGG : dnad |
− | {{#set: | + | {{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}} |
− | {{#set: | + | {{#set: common name=nicotinate adenine dinucleotide}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=662.399 }} |
− | {{#set: consumed by= | + | {{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}} |
− | {{#set: produced by=RXN | + | {{#set: consumed by=DNNH}} |
+ | {{#set: produced by=NICONUCADENYLYLTRAN-RXN}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite DEAMIDO-NAD
- smiles:
- C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)
- common name:
- nicotinate adenine dinucleotide
- inchi key:
- InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
- molecular weight:
- 662.399
- Synonym(s):
- Deamino-NAD+
- NaADN
- deamido-NAD+
- deamidonicotinamide adenine dinucleoetide
- deamido-NAD
- NAAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6450-77-7
- DRUGBANK : DB04099
- PUBCHEM:
- HMDB : HMDB01179
- LIGAND-CPD:
- CHEBI:
- BIGG : dnad
"C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)" cannot be used as a page name in this wiki.