Difference between revisions of "CPD-702"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenzy...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-nitrobenzyl alcohol |
| + | * inchi key: | ||
| + | ** InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 153.137 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4NBA |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5141]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 619-73-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69275 69275] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.13585105.html 13585105] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41214 41214] |
| − | * | + | * NCI: |
| − | {{#set: smiles | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5389 5389] |
| − | {{#set: | + | {{#set: smiles=C(O)C1(C=CC(=CC=1)[N+]([O-])=O)}} |
| − | {{#set: | + | {{#set: common name=4-nitrobenzyl alcohol}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=153.137 }} |
| − | {{#set: produced by= | + | {{#set: common name=4NBA}} |
| + | {{#set: produced by=RXN0-5141}} | ||
Latest revision as of 21:24, 21 March 2018
Contents
Metabolite CPD-702
- smiles:
- C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
- common name:
- 4-nitrobenzyl alcohol
- inchi key:
- InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
- molecular weight:
- 153.137
- Synonym(s):
- 4NBA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
