Difference between revisions of "Tiso gene 12142"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_12142 == * right end position: ** 4381 * transcription direction: ** NEGATIVE * left end position: ** 296 * centisome position: ** 2.524735...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12142 == |
− | * | + | * right end position: |
− | ** | + | ** 4381 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 296 |
− | * | + | * centisome position: |
− | ** | + | ** 2.5247357 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-LIGASE-ATP-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | + | * Reaction: [[RXN-17917]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-17918]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17919]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4381}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=296}} | |
− | + | {{#set: centisome position=2.5247357 }} | |
− | + | {{#set: reaction associated=DNA-LIGASE-ATP-RXN|RXN-17917|RXN-17918|RXN-17919}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:25, 21 March 2018
Gene Tiso_gene_12142
- right end position:
- 4381
- transcription direction:
- NEGATIVE
- left end position:
- 296
- centisome position:
- 2.5247357
- Synonym(s):
Reactions associated
- Reaction: DNA-LIGASE-ATP-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17917
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17918
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17919
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation