Difference between revisions of "CPD-6746"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.5.7-RXN 6.3.5.7-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glutamyl-tRNA(Gln) amid...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * common name: *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.5.7-RXN 6.3.5.7-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
 
* common name:
 
* common name:
−
** Glutamyl-tRNA(Gln) amidotransferase subunit A
+
** 1D-myo-inositol 2-monophosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/6.3.5.7 EC-6.3.5.7]
+
** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-myo-inositol 2-monophosphate
 +
** Ins(2)P1
 +
** Ins(2)P
 +
** Ins2P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7253]]
−
** 1 [[WATER]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[L-glutamyl-tRNAGln]][c] '''=>''' 1 [[GLT]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Charged-GLN-tRNAs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 ATP[c] '''+''' 1 L-glutamine[c] '''+''' 1 an L-glutamyl-[tRNAGln][c] '''=>''' 1 L-glutamate[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 an L-glutaminyl-[tRNAgln][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12219]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5921]], glutaminyl-tRNAgln biosynthesis via transamidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5921 PWY-5921]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17521 17521]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383]
−
* LIGAND-RXN:
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03905 R03905]
+
{{#set: common name=1D-myo-inositol 2-monophosphate}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}}
−
{{#set: common name=Glutamyl-tRNA(Gln) amidotransferase subunit A}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: ec number=EC-6.3.5.7}}
+
{{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}}
−
{{#set: gene associated=Tiso_gene_12219}}
+
{{#set: consumed by=RXN-7253}}
−
{{#set: in pathway=PWY-5921}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation}}
+

Latest revision as of 20:25, 21 March 2018

Metabolite CPD-6746

  • smiles:
    • C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
  • common name:
    • 1D-myo-inositol 2-monophosphate
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
  • molecular weight:
    • 258.121
  • Synonym(s):
    • D-myo-inositol 2-monophosphate
    • Ins(2)P1
    • Ins(2)P
    • Ins2P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6746&oldid=48590"