Difference between revisions of "THIAMIN-TRIPHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-TRIPHOSPHATASE-RXN THIAMIN-TRIPHOSPHATASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-TRIPHOSPHATASE-RXN THIAMIN-TRIPHOSPHATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cyth_domain-containing_protein |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.28 EC-3.6.1.28] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[1. | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-611]][c] '''=>''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 thiamine triphosphate[c] '''=>''' 1 thiamine diphosphate[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_4013]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7369]], thiamine triphosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7369 PWY-7369] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11744 11744] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00618 R00618] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=cyth_domain-containing_protein}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-3.6.1.28}} |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_4013}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-7369}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction THIAMIN-TRIPHOSPHATASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- cyth_domain-containing_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-611[c] => 1 THIAMINE-PYROPHOSPHATE[c] + 1 PROTON[c] + 1 Pi[c]
- With common name(s):
- 1 H2O[c] + 1 thiamine triphosphate[c] => 1 thiamine diphosphate[c] + 1 H+[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_4013
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7369, thiamine triphosphate metabolism: PWY-7369
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links