Difference between revisions of "131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9000 RXN-9000] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9000 RXN-9000] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** 611.959   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5284]]
−
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-9459]][c] '''=>''' 1 [[CPD-9460]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-5283]]
−
** 1 UDP-α-D-glucuronate[c] '''+''' 1 oleanolate[c] '''=>''' 1 oleanolate 3 β-D-glucuronoside[c] '''+''' 1 H+[c] '''+''' 1 UDP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14140]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14141]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5756]], saponin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5756 PWY-5756]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=exostosin_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440]
−
{{#set: ec number=EC-2.4.1.17}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490]
−
{{#set: in pathway=PWY-5756}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}}
 +
{{#set: molecular weight=611.959    }}
 +
{{#set: consumed by=RXN-5284}}
 +
{{#set: produced by=RXN-5283}}

Latest revision as of 20:25, 21 March 2018

Metabolite 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
  • common name:
    • 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
  • molecular weight:
    • 611.959
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M&oldid=48621"