Difference between revisions of "RXN-13313"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13313 RXN-13313] == * direction: ** LEFT-TO-RIGHT * common name: ** protein-tyrosine_phosphatas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13313 RXN-13313] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 2-monophosphate
+
** protein-tyrosine_phosphatase_mitochondrial_1
−
* molecular weight:
+
* ec number:
−
** 258.121   
+
** [http://enzyme.expasy.org/EC/3.1.3.27 EC-3.1.3.27]
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 2-monophosphate
 
−
** Ins(2)P1
 
−
** Ins(2)P
 
−
** Ins2P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7253]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPDQT-520]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CPD-2183]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 phosphatidylglycerophosphate (1-octadecenoyl(9Z), 2-palmitoyl)[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 1-oleoyl-2-palmitoyl-phosphatidylglycerol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18092]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383]
+
{{#set: common name=protein-tyrosine_phosphatase_mitochondrial_1}}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}}
+
{{#set: ec number=EC-3.1.3.27}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}}
+
{{#set: gene associated=Tiso_gene_18092}}
−
{{#set: common name=1D-myo-inositol 2-monophosphate}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=258.121    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: consumed by=RXN-7253}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:25, 21 March 2018

Reaction RXN-13313

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • protein-tyrosine_phosphatase_mitochondrial_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 phosphatidylglycerophosphate (1-octadecenoyl(9Z), 2-palmitoyl)[c] + 1 H2O[c] => 1 phosphate[c] + 1 1-oleoyl-2-palmitoyl-phosphatidylglycerol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13313&oldid=48625"