Difference between revisions of "CPD1F-128"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6091 == * left end position: ** 6602 * transcription direction: ** POSITIVE * right end position: ** 10255 * centisome position: ** 52.4551...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * comm...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) |
| − | * | + | * common name: |
| − | ** | + | ** ent-kaurene |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 272.473 |
* Synonym(s): | * Synonym(s): | ||
| + | ** ent-kaur-16-ene | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.14.13.78-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104130002 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966109 11966109] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.16737395.html 16737395] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090] | ||
| + | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}} | ||
| + | {{#set: common name=ent-kaurene}} | ||
| + | {{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}} | ||
| + | {{#set: molecular weight=272.473 }} | ||
| + | {{#set: common name=ent-kaur-16-ene}} | ||
| + | {{#set: consumed by=1.14.13.78-RXN}} | ||
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite CPD1F-128
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
- common name:
- ent-kaurene
- inchi key:
- InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
- molecular weight:
- 272.473
- Synonym(s):
- ent-kaur-16-ene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.
