Difference between revisions of "CPD-16015"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * common name: ** hypoxan...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16015 CPD-16015] == * smiles: ** CC(=N)C(=O)[O-] * common name: ** 2-iminopropanoate * inch...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16015 CPD-16015] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=N)C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** 2-iminopropanoate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DUAWRLXHCUAWMK-UHFFFAOYSA-M |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 86.07 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15127]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15124]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289240 86289240] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77456 77456] |
− | + | {{#set: smiles=CC(=N)C(=O)[O-]}} | |
− | {{#set: smiles= | + | {{#set: common name=2-iminopropanoate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=DUAWRLXHCUAWMK-UHFFFAOYSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=86.07 }} |
− | {{#set: molecular weight= | + | {{#set: consumed by=RXN-15127}} |
− | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-15124}} |
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite CPD-16015
- smiles:
- CC(=N)C(=O)[O-]
- common name:
- 2-iminopropanoate
- inchi key:
- InChIKey=DUAWRLXHCUAWMK-UHFFFAOYSA-M
- molecular weight:
- 86.07
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=N)C(=O)[O-" cannot be used as a page name in this wiki.