Difference between revisions of "GDPREDUCT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * c...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPREDUCT-RXN GDPREDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diph...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPREDUCT-RXN GDPREDUCT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** ribonucleoside-diphosphate_reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[GDP]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[DGDP]][c] '''+''' 1 [[Ox-Thioredoxin]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 a reduced thioredoxin[c] '''+''' 1 GDP[c] '''=>''' 1 H2O[c] '''+''' 1 dGDP[c] '''+''' 1 an oxidized thioredoxin[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10138]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10617]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9916]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9915]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7222]], guanosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7222 PWY-7222] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7226]], guanosine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7226 PWY-7226] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28030 28030] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02019 R02019] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=ribonucleoside-diphosphate_reductase}} |
− | + | {{#set: ec number=EC-1.17.4.1}} | |
− | + | {{#set: gene associated=Tiso_gene_10138|Tiso_gene_10617|Tiso_gene_9916|Tiso_gene_9915}} | |
− | + | {{#set: in pathway=PWY-7222|PWY-7226}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology|manual|annotation}} |
− | {{#set: common name= | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction GDPREDUCT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ribonucleoside-diphosphate_reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Red-Thioredoxin[c] + 1 GDP[c] => 1 WATER[c] + 1 DGDP[c] + 1 Ox-Thioredoxin[c]
- With common name(s):
- 1 a reduced thioredoxin[c] + 1 GDP[c] => 1 H2O[c] + 1 dGDP[c] + 1 an oxidized thioredoxin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10138
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10617
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_9916
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9915
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
Pathways
- PWY-7222, guanosine deoxyribonucleotides de novo biosynthesis II: PWY-7222
- 3 reactions found over 4 reactions in the full pathway
- PWY-7226, guanosine deoxyribonucleotides de novo biosynthesis I: PWY-7226
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links